ChemNet > CAS > 2370-61-8 dl-O-tyrosine
2370-61-8 dl-O-tyrosine
| Nome del prodotto |
dl-O-tyrosine |
| Nome inglese |
dl-O-tyrosine; 3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH; 2-hydroxyphenylalanine; 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt) |
| Formula molecolare |
C13H16N2O5 |
| Peso Molecolare |
280.2765 |
| InChI |
InChI=1/C11H14N2O.C2H2O4/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11;3-1(4)2(5)6/h1-4,6,9,13-14H,5,7,12H2;(H,3,4)(H,5,6) |
| Numero CAS |
2370-61-8 |
| EINECS |
219-134-8 |
| Struttura molecolare |
|
| Punto di fusione |
260℃ |
| Punto di ebollizione |
654.4°C at 760 mmHg |
| Punto d'infiammabilità |
349.5°C |
| Pressione di vapore |
5.14E-18mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
