ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| Nome del prodotto |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Nome inglese |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate; 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| Formula molecolare |
C11H15NO3 |
| Peso Molecolare |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| Numero CAS |
2386-26-7 |
| Struttura molecolare |
|
| Densità |
1.125g/cm3 |
| Punto di fusione |
139℃ |
| Punto di ebollizione |
348.9°C at 760 mmHg |
| Indice di rifrazione |
1.517 |
| Punto d'infiammabilità |
164.8°C |
| Pressione di vapore |
4.89E-05mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
