ChemNet > CAS > 24426-16-2 N,N-Diethyldiethylenetriamine
24426-16-2 N,N-Diethyldiethylenetriamine
| Nome del prodotto |
N,N-Diethyldiethylenetriamine |
| Nome inglese |
N,N-Diethyldiethylenetriamine; N,N-Diethyldiethykenetriamine; N-(2-Diethylaminoethyl)ethylenediamine; N'-(2-aminoethyl)-N,N-diethylethane-1,2-diamine; N'-(2-ammonioethyl)-N,N-diethylethane-1,2-diaminium |
| Formula molecolare |
C8H24N3 |
| Peso Molecolare |
162.2946 |
| InChI |
InChI=1/C8H21N3/c1-3-11(4-2)8-7-10-6-5-9/h10H,3-9H2,1-2H3/p+3 |
| Numero CAS |
24426-16-2 |
| EINECS |
246-242-2 |
| Struttura molecolare |
|
| Punto di ebollizione |
227°C at 760 mmHg |
| Punto d'infiammabilità |
91.1°C |
| Pressione di vapore |
0.0796mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
