ChemNet > CAS > 24431-27-4 (4-Ethylphenoxy)-acetic acid
24431-27-4 (4-Ethylphenoxy)-acetic acid
| Nome del prodotto |
(4-Ethylphenoxy)-acetic acid |
| Nome inglese |
(4-Ethylphenoxy)-acetic acid; 4-Ethylphenoxyacetic acid |
| Formula molecolare |
C10H12O3 |
| Peso Molecolare |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-8-3-5-9(6-4-8)13-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| Numero CAS |
24431-27-4 |
| EINECS |
246-245-9 |
| Struttura molecolare |
|
| Densità |
1.144g/cm3 |
| Punto di ebollizione |
309.6°C at 760 mmHg |
| Indice di rifrazione |
1.53 |
| Punto d'infiammabilità |
121.6°C |
| Pressione di vapore |
0.000272mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
