ChemNet > CAS > 24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
| Nome del prodotto |
Ethyl 5-hydroxyindole-2-carboxylate |
| Nome inglese |
Ethyl 5-hydroxyindole-2-carboxylate; 5-Hydroxyindole-2-carboxylic acid ethyl ester; ethyl 5-hydroxy-1H-indole-2-carboxylate; (1-benzylpiperidin-3-yl)methanol |
| Formula molecolare |
C13H19NO |
| Peso Molecolare |
205.2961 |
| InChI |
InChI=1/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
| Numero CAS |
24985-85-1 |
| EINECS |
246-554-9 |
| Struttura molecolare |
|
| Densità |
1.056g/cm3 |
| Punto di ebollizione |
294.068°C at 760 mmHg |
| Indice di rifrazione |
1.551 |
| Punto d'infiammabilità |
123.378°C |
| Pressione di vapore |
0.001mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
