26739-53-7 Guanidine stearate
Nome del prodotto |
Guanidine stearate |
Nome inglese |
Guanidine stearate;Octadecanoic acid, compd. with guanidine (1:1); Stearic acid, compound with guanidine (1:1); octadecanoic acid - guanidine (1:1) |
Formula molecolare |
C19H41N3O2 |
Peso Molecolare |
343.5477 |
InChI |
InChI=1/C18H36O2.CH5N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;2-1(3)4/h2-17H2,1H3,(H,19,20);(H5,2,3,4) |
Numero CAS |
26739-53-7 |
EINECS |
247-950-4 |
Struttura molecolare |
|
Punto di ebollizione |
359.4°C at 760 mmHg |
Punto d'infiammabilità |
162.4°C |
Pressione di vapore |
8.58E-06mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
|
Sicurezza Descrizione |
|
|