ChemNet > CAS > 27129-87-9 3,5-dimethylbenzyl alcohol
27129-87-9 3,5-dimethylbenzyl alcohol
| Nome del prodotto |
3,5-dimethylbenzyl alcohol |
| Nome inglese |
3,5-dimethylbenzyl alcohol; 3,5-Dimethylbenzylalcohol; (3,5-dimethylphenyl)methanol |
| Formula molecolare |
C9H12O |
| Peso Molecolare |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-3-8(2)5-9(4-7)6-10/h3-5,10H,6H2,1-2H3 |
| Numero CAS |
27129-87-9 |
| EINECS |
248-241-2 |
| Struttura molecolare |
|
| Densità |
1.002g/cm3 |
| Punto di ebollizione |
219.5°C at 760 mmHg |
| Indice di rifrazione |
1.536 |
| Punto d'infiammabilità |
106.7°C |
| Pressione di vapore |
0.0689mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
