ChemNet > CAS > 27761-26-8 Fast Red B salt
27761-26-8 Fast Red B salt
| Nome del prodotto |
Fast Red B salt |
| Nome inglese |
Fast Red B salt;2-methoxy-4-nitrobenzenediazonium |
| Formula molecolare |
C7H6N3O3 |
| Peso Molecolare |
180.1403 |
| InChI |
InChI=1/C7H6N3O3/c1-13-7-4-5(10(11)12)2-3-6(7)9-8/h2-4H,1H3/q+1 |
| Numero CAS |
27761-26-8 |
| EINECS |
248-642-2 |
| Struttura molecolare |
|
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21:Harmful by inhalation and in contact with skin.;
R33:Danger of cummulative effects.;
|
| Sicurezza Descrizione |
|
|
