ChemNet > CAS > 2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
2855-27-8 1,2,4-Trivinylcyclohexane, mixture of isomers
| Nome del prodotto |
1,2,4-Trivinylcyclohexane, mixture of isomers |
| Nome inglese |
1,2,4-Trivinylcyclohexane, mixture of isomers; cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
| Formula molecolare |
C12H18 |
| Peso Molecolare |
162.2713 |
| InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
| Numero CAS |
2855-27-8 |
| EINECS |
220-668-9 |
| Struttura molecolare |
|
| Densità |
0.96g/cm3 |
| Punto di ebollizione |
198.4°C at 760 mmHg |
| Indice di rifrazione |
1.628 |
| Punto d'infiammabilità |
68.9°C |
| Pressione di vapore |
0.508mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
