ChemNet > CAS > 29059-24-3 myristic acid, monoester with propane-1,2-diol
29059-24-3 myristic acid, monoester with propane-1,2-diol
| Nome del prodotto |
myristic acid, monoester with propane-1,2-diol |
| Nome inglese |
myristic acid, monoester with propane-1,2-diol;Propylene glycol monomyristate; Propylene glycol myristate; Tetradecanoic acid, monoester with 1,2-propanediol; Myristic acid, monoester with propane-1,2-diol; 2-hydroxypropyl tetradecanoate |
| Formula molecolare |
C17H34O3 |
| Peso Molecolare |
286.4501 |
| InChI |
InChI=1/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(19)20-15-16(2)18/h16,18H,3-15H2,1-2H3 |
| Numero CAS |
29059-24-3 |
| EINECS |
249-395-3 |
| Struttura molecolare |
|
| Densità |
0.922g/cm3 |
| Punto di ebollizione |
392.2°C at 760 mmHg |
| Indice di rifrazione |
1.453 |
| Punto d'infiammabilità |
149.1°C |
| Pressione di vapore |
8.97E-08mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
|
|
