ChemNet > CAS > 301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
| Nome del prodotto |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
| Nome inglese |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid; 4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
| Formula molecolare |
C9H13BO3 |
| Peso Molecolare |
180.0087 |
| InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
| Numero CAS |
301699-39-8 |
| Struttura molecolare |
|
| Densità |
1.11g/cm3 |
| Punto di fusione |
235-242℃ |
| Punto di ebollizione |
335.8°C at 760 mmHg |
| Indice di rifrazione |
1.517 |
| Punto d'infiammabilità |
156.9°C |
| Pressione di vapore |
4.6E-05mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
