ChemNet > CAS > 30273-11-1 4-sec-Butylaniline
30273-11-1 4-sec-Butylaniline
| Nome del prodotto |
4-sec-Butylaniline |
| Nome inglese |
4-sec-Butylaniline; benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
| Formula molecolare |
C10H15N |
| Peso Molecolare |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
| Numero CAS |
30273-11-1 |
| EINECS |
250-108-9 |
| Struttura molecolare |
|
| Densità |
0.942g/cm3 |
| Punto di ebollizione |
244.2°C at 760 mmHg |
| Indice di rifrazione |
1.535 |
| Punto d'infiammabilità |
107.8°C |
| Pressione di vapore |
0.0308mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
