30544-34-4 2,3-Dibromofuran
Nome del prodotto |
2,3-Dibromofuran |
Nome inglese |
2,3-Dibromofuran; |
Formula molecolare |
C4H2Br2O |
Peso Molecolare |
225.8661 |
InChI |
InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
Numero CAS |
30544-34-4 |
Struttura molecolare |
|
Densità |
2.159g/cm3 |
Punto di ebollizione |
175.6°C at 760 mmHg |
Indice di rifrazione |
1.562 |
Punto d'infiammabilità |
60°C |
Pressione di vapore |
1.53mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|