ChemNet > CAS > 30806-83-8 Ethyl 4-isocyanatobenzoate
30806-83-8 Ethyl 4-isocyanatobenzoate
| Nome del prodotto |
Ethyl 4-isocyanatobenzoate |
| Nome inglese |
Ethyl 4-isocyanatobenzoate; 4-(Ethoxycarbonyl)phenyl isocyanate; 4-Carboethoxyphenyl isocyanate; 4-Isocyanatobenzoic acid ethyl ester; 4-Ethoxycarbonyphenyl isocyanate |
| Formula molecolare |
C10H9NO3 |
| Peso Molecolare |
191.1834 |
| InChI |
InChI=1/C10H9NO3/c1-2-14-10(13)8-3-5-9(6-4-8)11-7-12/h3-6H,2H2,1H3 |
| Numero CAS |
30806-83-8 |
| EINECS |
250-344-2 |
| Struttura molecolare |
|
| Densità |
1.12g/cm3 |
| Punto di fusione |
27-29℃ |
| Punto di ebollizione |
313.2°C at 760 mmHg |
| Indice di rifrazione |
1.524 |
| Punto d'infiammabilità |
126.7°C |
| Pressione di vapore |
0.000504mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
