3141-25-1 2,3,4-Tribromothiophene
Nome del prodotto |
2,3,4-Tribromothiophene |
Nome inglese |
2,3,4-Tribromothiophene; |
Formula molecolare |
C4HBr3S |
Peso Molecolare |
320.8277 |
InChI |
InChI=1/C4HBr3S/c5-2-1-8-4(7)3(2)6/h1H |
Numero CAS |
3141-25-1 |
EINECS |
221-545-2 |
Struttura molecolare |
|
Densità |
2.516g/cm3 |
Punto di ebollizione |
277.5°C at 760 mmHg |
Indice di rifrazione |
1.671 |
Punto d'infiammabilità |
121.6°C |
Pressione di vapore |
0.00762mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|