ChemNet > CAS > 3319-99-1 2-(2-thienyl)pyridine
3319-99-1 2-(2-thienyl)pyridine
| Nome del prodotto |
2-(2-thienyl)pyridine |
| Nome inglese |
2-(2-thienyl)pyridine; 2-(2-Pyridyl)thiophene; 2-(thiophen-2-yl)pyridine |
| Formula molecolare |
C9H7NS |
| Peso Molecolare |
161.2236 |
| InChI |
InChI=1/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
| Numero CAS |
3319-99-1 |
| EINECS |
222-022-1 |
| Struttura molecolare |
|
| Densità |
1.173g/cm3 |
| Punto di ebollizione |
268°C at 760 mmHg |
| Indice di rifrazione |
1.604 |
| Punto d'infiammabilità |
115°C |
| Pressione di vapore |
0.013mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
