ChemNet > CAS > 3430-23-7 3,5-Dibromo-4-methylpyridine
3430-23-7 3,5-Dibromo-4-methylpyridine
| Nome del prodotto |
3,5-Dibromo-4-methylpyridine |
| Nome inglese |
3,5-Dibromo-4-methylpyridine; 3,5-Dibromo-4-picoline |
| Formula molecolare |
C6H5Br2N |
| Peso Molecolare |
250.9186 |
| InChI |
InChI=1/C6H5Br2N/c1-4-5(7)2-9-3-6(4)8/h2-3H,1H3 |
| Numero CAS |
3430-23-7 |
| Struttura molecolare |
|
| Densità |
1.911g/cm3 |
| Punto di ebollizione |
243°C at 760 mmHg |
| Indice di rifrazione |
1.593 |
| Punto d'infiammabilità |
100.7°C |
| Pressione di vapore |
0.0513mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
