ChemNet > CAS > 3512-13-8 2,3,4,6-Tetrafluoropyridine
3512-13-8 2,3,4,6-Tetrafluoropyridine
| Nome del prodotto |
2,3,4,6-Tetrafluoropyridine |
| Nome inglese |
2,3,4,6-Tetrafluoropyridine; |
| Formula molecolare |
C5HF4N |
| Peso Molecolare |
151.0618 |
| InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
| Numero CAS |
3512-13-8 |
| Struttura molecolare |
|
| Densità |
1.518g/cm3 |
| Punto di ebollizione |
114.6°C at 760 mmHg |
| Indice di rifrazione |
1.403 |
| Punto d'infiammabilità |
23.1°C |
| Pressione di vapore |
23.4mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
