ChemNet > CAS > 35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
| Nome del prodotto |
ethyl 2-(3-methoxyphenyl)acetate |
| Nome inglese |
ethyl 2-(3-methoxyphenyl)acetate; Ethyl 3-methoxyphenylacetate |
| Formula molecolare |
C11H14O3 |
| Peso Molecolare |
194.2271 |
| InChI |
InChI=1/C11H14O3/c1-3-14-11(12)8-9-5-4-6-10(7-9)13-2/h4-7H,3,8H2,1-2H3 |
| Numero CAS |
35553-92-5 |
| EINECS |
252-614-5 |
| Struttura molecolare |
|
| Densità |
1.062g/cm3 |
| Punto di ebollizione |
271.6°C at 760 mmHg |
| Indice di rifrazione |
1.497 |
| Punto d'infiammabilità |
108.5°C |
| Pressione di vapore |
0.00637mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
