ChemNet > CAS > 35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
35947-10-5 2-Methyl-1-(3-methylphenyl)piperazine
| Nome del prodotto |
2-Methyl-1-(3-methylphenyl)piperazine |
| Nome inglese |
2-Methyl-1-(3-methylphenyl)piperazine; 2-Methyl-1-(m-tolyl)-piperazine; (3S)-3-methyl-4-(3-methylphenyl)piperazin-1-ium; (3R)-3-methyl-4-(3-methylphenyl)piperazin-1-ium |
| Formula molecolare |
C12H19N2 |
| Peso Molecolare |
191.2921 |
| InChI |
InChI=1/C12H18N2/c1-10-4-3-5-12(8-10)14-7-6-13-9-11(14)2/h3-5,8,11,13H,6-7,9H2,1-2H3/p+1/t11-/m1/s1 |
| Numero CAS |
35947-10-5 |
| EINECS |
252-810-0 |
| Struttura molecolare |
|
| Punto di ebollizione |
326.9°C at 760 mmHg |
| Punto d'infiammabilità |
147.4°C |
| Pressione di vapore |
0.00021mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|