ChemNet > CAS > 36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid
36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid
| Nome del prodotto |
2,5-Dichlorothiophene-3-carboxylic acid |
| Nome inglese |
2,5-Dichlorothiophene-3-carboxylic acid; 2,5-Dichloro-3-Thiopheneformic Acid; 2,5-dichlorothiophene-3-carboxylate |
| Formula molecolare |
C5HCl2O2S |
| Peso Molecolare |
196.0318 |
| InChI |
InChI=1/C5H2Cl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)/p-1 |
| Numero CAS |
36157-41-2 |
| Struttura molecolare |
|
| Punto di ebollizione |
296.6°C at 760 mmHg |
| Punto d'infiammabilità |
133.2°C |
| Pressione di vapore |
0.000641mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
