3681-71-8 cis-3-hexenyl acetate
| Nome del prodotto |
cis-3-hexenyl acetate |
| Nome inglese |
cis-3-hexenyl acetate; Cis-3-Hexene-1-Yl Acetate; 3-Hexen-1-ol, acetate, (Z)-; ACETATO DE CIS-3-HEXENILO; Leaf acetate; Verdural extra; (Z)-3-hexenyl acetate; cis-3-Hexen-1-yl acetate |
| Formula molecolare |
C8H14O2 |
| Peso Molecolare |
142.2 |
| InChI |
InChI=1/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
| Numero CAS |
3681-71-8 |
| EINECS |
222-960-1 |
| Struttura molecolare |
|
| Densità |
0.897 |
| Punto di ebollizione |
75-76℃ (23 mmHg) |
| Indice di rifrazione |
1.427 |
| Punto d'infiammabilità |
135�H |
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|