ChemNet > CAS > 374898-01-8 (R)-1-(4-Fluorophenyl)ethylamine
374898-01-8 (R)-1-(4-Fluorophenyl)ethylamine
| Nome del prodotto |
(R)-1-(4-Fluorophenyl)ethylamine |
| Nome inglese |
(R)-1-(4-Fluorophenyl)ethylamine; (R)-(+)-1-(4-Fluorophenyl)ethylamine; (R)-4-Fluoro-alpha-methylbenzylamine; (1R)-1-(4-fluorophenyl)ethanamine |
| Formula molecolare |
C8H10FN |
| Peso Molecolare |
139.1701 |
| InChI |
InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/t6-/m1/s1 |
| Numero CAS |
374898-01-8 |
| Struttura molecolare |
|
| Densità |
1.063g/cm3 |
| Punto di ebollizione |
185.4°C at 760 mmHg |
| Indice di rifrazione |
1.512 |
| Punto d'infiammabilità |
74°C |
| Pressione di vapore |
0.698mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
