ChemNet > CAS > 37593-06-9 1-(4-decilfenil)ethan-1-one
37593-06-9 1-(4-decilfenil)ethan-1-one
| Nome del prodotto |
1-(4-decilfenil)ethan-1-one |
| Sinonimi |
1-(4-decilfenil)etanone |
| Nome inglese |
1-(4-decylphenyl)ethan-1-one;1-(4-decylphenyl)ethanone |
| Formula molecolare |
C18H28O |
| Peso Molecolare |
260.4143 |
| InChI |
InChI=1/C18H28O/c1-3-4-5-6-7-8-9-10-11-17-12-14-18(15-13-17)16(2)19/h12-15H,3-11H2,1-2H3 |
| Numero CAS |
37593-06-9 |
| Struttura molecolare |
|
| Densità |
0.911g/cm3 |
| Punto di fusione |
33℃ |
| Punto di ebollizione |
371.4°C at 760 mmHg |
| Indice di rifrazione |
1.491 |
| Punto d'infiammabilità |
156.6°C |
| Pressione di vapore |
1.04E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|