ChemNet > CAS > 39232-91-2 3-Methoxyphenylhydrazine hydrochloride
39232-91-2 3-Methoxyphenylhydrazine hydrochloride
| Nome del prodotto |
3-Methoxyphenylhydrazine hydrochloride |
| Nome inglese |
3-Methoxyphenylhydrazine hydrochloride; 3-Methoxyphenylhydrazine HCl; (3-methoxyphenyl)hydrazine; m-Methoxyphenylhydrazine hydrochloride; (3-Methoxy-phenyl)-hydrazine HCl |
| Formula molecolare |
C7H11ClN2O |
| Peso Molecolare |
174.628 |
| InChI |
InChI=1/C7H10N2O.ClH/c1-10-7-4-2-3-6(5-7)9-8;/h2-5,9H,8H2,1H3;1H |
| Numero CAS |
39232-91-2 |
| EINECS |
254-368-4 |
| Struttura molecolare |
|
| Punto di ebollizione |
275.3°C at 760 mmHg |
| Punto d'infiammabilità |
120.3°C |
| Pressione di vapore |
0.00515mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
