ChemNet > CAS > 40397-98-6 2,5-dimethylphenyl isocyanate
40397-98-6 2,5-dimethylphenyl isocyanate
| Nome del prodotto |
2,5-dimethylphenyl isocyanate |
| Nome inglese |
2,5-dimethylphenyl isocyanate; 2,5-Isocyanatoxylene; 2-isocyanato-1,4-dimethylbenzene |
| Formula molecolare |
C9H9NO |
| Peso Molecolare |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-7-3-4-8(2)9(5-7)10-6-11/h3-5H,1-2H3 |
| Numero CAS |
40397-98-6 |
| Struttura molecolare |
|
| Densità |
0.98g/cm3 |
| Punto di ebollizione |
224.4°C at 760 mmHg |
| Indice di rifrazione |
1.515 |
| Punto d'infiammabilità |
78.8°C |
| Pressione di vapore |
0.0914mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
