ChemNet > CAS > 40532-06-7 2,5-Dimethoxyphenyl isothiocyanate
40532-06-7 2,5-Dimethoxyphenyl isothiocyanate
| Nome del prodotto |
2,5-Dimethoxyphenyl isothiocyanate |
| Nome inglese |
2,5-Dimethoxyphenyl isothiocyanate;2-isothiocyanato-1,4-dimethoxybenzene |
| Formula molecolare |
C9H9NO2S |
| Peso Molecolare |
195.2383 |
| InChI |
InChI=1/C9H9NO2S/c1-11-7-3-4-9(12-2)8(5-7)10-6-13/h3-5H,1-2H3 |
| Numero CAS |
40532-06-7 |
| Struttura molecolare |
|
| Densità |
1.12g/cm3 |
| Punto di ebollizione |
338.1°C at 760 mmHg |
| Indice di rifrazione |
1.537 |
| Punto d'infiammabilità |
158.3°C |
| Pressione di vapore |
0.000197mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
