ChemNet > CAS > 42087-80-9 4-cloro-2-nitrobenzoato di metile
42087-80-9 4-cloro-2-nitrobenzoato di metile
| Nome del prodotto |
4-cloro-2-nitrobenzoato di metile |
| Sinonimi |
; estere metilico dell'acido 4-cloro-2-nitrobenzoico |
| Nome inglese |
Methyl 4-Chloro-2-Nitrobenzoate; 4-Chloro-2-nitrobenzoic acid methyl ester |
| Formula molecolare |
C8H6ClNO4 |
| Peso Molecolare |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
| Numero CAS |
42087-80-9 |
| EINECS |
255-654-1 |
| Struttura molecolare |
|
| Densità |
1.426g/cm3 |
| Punto di fusione |
43-45℃ |
| Punto di ebollizione |
285.6°C at 760 mmHg |
| Indice di rifrazione |
1.568 |
| Punto d'infiammabilità |
126.5°C |
| Pressione di vapore |
0.00277mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|