ChemNet > CAS > 437-64-9 4',5-Dihydroxy-7-methoxyflavone
437-64-9 4',5-Dihydroxy-7-methoxyflavone
| Nome del prodotto |
4',5-Dihydroxy-7-methoxyflavone |
| Nome inglese |
4',5-Dihydroxy-7-methoxyflavone; Genkwanin; Gengkwanin |
| Formula molecolare |
C16H12O5 |
| Peso Molecolare |
284.26 |
| InChI |
InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Numero CAS |
437-64-9 |
| Struttura molecolare |
|
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
