455-67-4 3-fluoropropiophenone
Nome del prodotto |
3-fluoropropiophenone |
Nome inglese |
3-fluoropropiophenone; 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
Formula molecolare |
C9H9FO |
Peso Molecolare |
152.1656 |
InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
Numero CAS |
455-67-4 |
Struttura molecolare |
|
Densità |
1.074g/cm3 |
Punto di ebollizione |
209.8°C at 760 mmHg |
Indice di rifrazione |
1.489 |
Punto d'infiammabilità |
79.8°C |
Pressione di vapore |
0.199mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|