ChemNet > CAS > 4693-91-8 4-methoxyphenylacetyl chloride
4693-91-8 4-methoxyphenylacetyl chloride
| Nome del prodotto |
4-methoxyphenylacetyl chloride |
| Nome inglese |
4-methoxyphenylacetyl chloride; Benzenacetyl chloride, 4-methoxy-; (p-Methoxyphenyl)acetyl chloride; (4-Methoxyphenyl)acetylchloride |
| Formula molecolare |
C9H9ClO2 |
| Peso Molecolare |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
| Numero CAS |
4693-91-8 |
| Struttura molecolare |
|
| Densità |
1.192g/cm3 |
| Punto di ebollizione |
280.1°C at 760 mmHg |
| Indice di rifrazione |
1.524 |
| Punto d'infiammabilità |
100°C |
| Pressione di vapore |
0.00387mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
