ChemNet > CAS > 4740-22-1 2-ammino-1-(4-nitrofenil)etano-1-one cloridrato idrato
4740-22-1 2-ammino-1-(4-nitrofenil)etano-1-one cloridrato idrato
| Nome del prodotto |
2-ammino-1-(4-nitrofenil)etano-1-one cloridrato idrato |
| Sinonimi |
2-ammino-1-(4-nitrofenil)etano cloridrato idrato |
| Nome inglese |
2-amino-1-(4-nitrophenyl)ethan-1-one hydrochloride hydrate;2-amino-1-(4-nitrophenyl)ethanone hydrochloride hydrate |
| Formula molecolare |
C8H11ClN2O4 |
| Peso Molecolare |
234.6369 |
| InChI |
InChI=1/C8H8N2O3.ClH.H2O/c9-5-8(11)6-1-3-7(4-2-6)10(12)13;;/h1-4H,5,9H2;1H;1H2 |
| Numero CAS |
4740-22-1 |
| Struttura molecolare |
|
| Punto di fusione |
134℃ |
| Punto di ebollizione |
339.1°C at 760 mmHg |
| Punto d'infiammabilità |
158.9°C |
| Pressione di vapore |
9.39E-05mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
