ChemNet > CAS > 488-87-9 2,5-dimetilresorcina
488-87-9 2,5-dimetilresorcina
| Nome del prodotto |
2,5-dimetilresorcina |
| Sinonimi |
2,5-dimetilbenzene-1,3-diolo |
| Nome inglese |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
| Formula molecolare |
C8H10O2 |
| Peso Molecolare |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| Numero CAS |
488-87-9 |
| EINECS |
207-688-3 |
| Struttura molecolare |
|
| Densità |
1.162g/cm3 |
| Punto di fusione |
161℃ |
| Punto di ebollizione |
284.1°C at 760 mmHg |
| Indice di rifrazione |
1.582 |
| Punto d'infiammabilità |
140.8°C |
| Pressione di vapore |
0.00178mmHg at 25°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
