ChemNet > CAS > 493-01-6;91-17-8 cis-Decahydronaphthalene
493-01-6;91-17-8 cis-Decahydronaphthalene
| Nome del prodotto |
cis-Decahydronaphthalene |
| Nome inglese |
cis-Decahydronaphthalene; cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
| Formula molecolare |
C10H18 |
| Peso Molecolare |
138.2499 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| Numero CAS |
493-01-6;91-17-8 |
| EINECS |
202-046-9 |
| Struttura molecolare |
|
| Densità |
0.873g/cm3 |
| Punto di fusione |
-31℃ |
| Punto di ebollizione |
190.879°C at 760 mmHg |
| Indice di rifrazione |
1.47 |
| Punto d'infiammabilità |
57.222°C |
| Solubilità in acqua |
6 mg/L at 20℃ |
| Pressione di vapore |
0.735mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
