ChemNet > CAS > 4946-13-8 4-Ethylthiophenol
4946-13-8 4-Ethylthiophenol
| Nome del prodotto |
4-Ethylthiophenol |
| Nome inglese |
4-Ethylthiophenol; 4-Ethylbenzenethiol; 4-ethylbenzenethiolate |
| Formula molecolare |
C8H9S |
| Peso Molecolare |
137.2226 |
| InChI |
InChI=1/C8H10S/c1-2-7-3-5-8(9)6-4-7/h3-6,9H,2H2,1H3/p-1 |
| Numero CAS |
4946-13-8 |
| Struttura molecolare |
|
| Punto di ebollizione |
211.7°C at 760 mmHg |
| Punto d'infiammabilità |
84°C |
| Pressione di vapore |
0.262mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36:Irritating to eyes.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
