ChemNet > CAS > 5002-26-6 4-Bromo-2-methylbiphenyl
5002-26-6 4-Bromo-2-methylbiphenyl
| Nome del prodotto |
4-Bromo-2-methylbiphenyl |
| Nome inglese |
4-Bromo-2-methylbiphenyl; |
| Formula molecolare |
C13H11Br |
| Peso Molecolare |
247.1304 |
| InChI |
InChI=1/C13H11Br/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h2-9H,1H3 |
| Numero CAS |
5002-26-6 |
| Struttura molecolare |
|
| Densità |
1.32g/cm3 |
| Punto di ebollizione |
308.015°C at 760 mmHg |
| Indice di rifrazione |
1.592 |
| Punto d'infiammabilità |
138.911°C |
| Pressione di vapore |
0.001mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
