| Nome del prodotto |
Isosorbide dimethyl ether |
| Nome inglese |
Isosorbide dimethyl ether; 1,4:3,6-Dianhydrosorbitol 2,5-dimethyl ether; Dimethyl isoborbide; O,O-Dimethylisosorbide; 1,4:3,6-Dianhydro-2,5-O-dimethyl-D-glucitol; (3R,6S)-3,6-dimethoxyhexahydrofuro[3,2-b]furan; 1,4:3,6-Dianhydro-D-glucitol dimethyl ether; 1,4:3,6-Dianhydro-D-sorbitol dimethyl ether; Dimethyl Isosorbide; DMI; 1,4:3,6-dianhydro-2,5-di-O-methyl-D-glucitol; 1,4:3,6-dianhydro-2,5-di-O-methylhexitol |
| Formula molecolare |
C8H14O4 |
| Peso Molecolare |
174.1944 |
| InChI |
InChI=1/C8H14O4/c1-9-5-3-11-8-6(10-2)4-12-7(5)8/h5-8H,3-4H2,1-2H3 |
| Numero CAS |
5306-85-4 |
| EINECS |
226-159-8 |
| Struttura molecolare |
|
| Densità |
1.15g/cm3 |
| Punto di ebollizione |
236.4°C at 760 mmHg |
| Indice di rifrazione |
1.465 |
| Punto d'infiammabilità |
108.3°C |
| Pressione di vapore |
0.073mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
