ChemNet > CAS > 5306-96-7 2,3-Dimethyl-p-phenylenediamine
5306-96-7 2,3-Dimethyl-p-phenylenediamine
| Nome del prodotto |
2,3-Dimethyl-p-phenylenediamine |
| Nome inglese |
2,3-Dimethyl-p-phenylenediamine;p-Phenylenediamine, 2,3-dimethyl-; 4-Amino-5,6-dimethylaniline; CCRIS 8132; 2,3-dimethylbenzene-1,4-diamine; 1,4-Diamino-2,3-dimethylbenzene |
| Formula molecolare |
C8H12N2 |
| Peso Molecolare |
136.1943 |
| InChI |
InChI=1/C8H12N2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,9-10H2,1-2H3 |
| Numero CAS |
5306-96-7 |
| Struttura molecolare |
|
| Densità |
1.076g/cm3 |
| Punto di ebollizione |
288.5°C at 760 mmHg |
| Indice di rifrazione |
1.618 |
| Punto d'infiammabilità |
151.5°C |
| Pressione di vapore |
0.00232mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
