ChemNet > CAS > 5321-49-3 1-(2-Phenylethyl)piperazine
5321-49-3 1-(2-Phenylethyl)piperazine
| Nome del prodotto |
1-(2-Phenylethyl)piperazine |
| Nome inglese |
1-(2-Phenylethyl)piperazine; 1-(Phenethyl)piperazine; 1-phenylethyl piperazine; N-(2-Phenylethyl)piperazine; 1-(2-cyclohexylethyl)piperazinediium |
| Formula molecolare |
C12H26N2 |
| Peso Molecolare |
198.3471 |
| InChI |
InChI=1/C12H24N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h12-13H,1-11H2/p+2 |
| Numero CAS |
5321-49-3 |
| EINECS |
226-186-5 |
| Struttura molecolare |
|
| Punto di ebollizione |
277.1°C at 760 mmHg |
| Punto d'infiammabilità |
99°C |
| Pressione di vapore |
0.00462mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
