ChemNet > CAS > 5408-52-6 L-Lysine L-glutamate
5408-52-6 L-Lysine L-glutamate
| Nome del prodotto |
L-Lysine L-glutamate |
| Nome inglese |
L-Lysine L-glutamate; Lysine glutamate; NSC 10855; Glutamic acid, L-, compd. with L-lysine (1:1); L-Glutamic acid, compd. with L-lysine (1:1); L-glutamic acid-L-lysine (1:1); glutamic acid-lysine (1:1); L-Lysine-L-Glutamate; L-Lys L-Glu; L-Lysine L-Glutamate |
| Formula molecolare |
C11H23N3O6 |
| Peso Molecolare |
293.3168 |
| InChI |
InChI=1/C6H14N2O2.C5H9NO4/c7-4-2-1-3-5(8)6(9)10;6-3(5(9)10)1-2-4(7)8/h5H,1-4,7-8H2,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10) |
| Numero CAS |
5408-52-6 |
| EINECS |
226-474-0 |
| Struttura molecolare |
|
| Punto di ebollizione |
311.5°C at 760 mmHg |
| Punto d'infiammabilità |
142.2°C |
| Pressione di vapore |
0.000123mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
|
|
