ChemNet > CAS > 5413-05-8 Ethyl 2-phenylacetoacetate
5413-05-8 Ethyl 2-phenylacetoacetate
| Nome del prodotto |
Ethyl 2-phenylacetoacetate |
| Nome inglese |
Ethyl 2-phenylacetoacetate; 2-Phenylacetoacetic acid ethyl ester; ethyl 3-oxo-2-phenylbutanoate; ethyl (2S)-3-oxo-2-phenylbutanoate |
| Formula molecolare |
C12H14O3 |
| Peso Molecolare |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-3-15-12(14)11(9(2)13)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3/t11-/m1/s1 |
| Numero CAS |
5413-05-8 |
| EINECS |
226-500-0 |
| Struttura molecolare |
|
| Densità |
1.087g/cm3 |
| Punto di ebollizione |
281.6°C at 760 mmHg |
| Indice di rifrazione |
1.503 |
| Punto d'infiammabilità |
119.2°C |
| Pressione di vapore |
0.00354mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
