5445-22-7 Methyl 2-bromooctanoate
Nome del prodotto |
Methyl 2-bromooctanoate |
Nome inglese |
Methyl 2-bromooctanoate; 2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
Formula molecolare |
C9H17BrO2 |
Peso Molecolare |
237.1341 |
InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
Numero CAS |
5445-22-7 |
EINECS |
226-644-4 |
Struttura molecolare |
|
Densità |
1.221g/cm3 |
Punto di ebollizione |
227.7°C at 760 mmHg |
Indice di rifrazione |
1.46 |
Punto d'infiammabilità |
101.9°C |
Pressione di vapore |
0.0763mmHg at 25°C |
Simboli di pericolo |
|
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|