ChemNet > CAS > 5447-99-4 3-Nitro-2-pentanol
5447-99-4 3-Nitro-2-pentanol
| Nome del prodotto |
3-Nitro-2-pentanol |
| Nome inglese |
3-Nitro-2-pentanol; 3-Nitro-2-pentanol,mixture of (?-threo and (?-erythro; 3-nitropentan-2-ol; (2R,3S)-3-nitropentan-2-ol; (2R,3R)-3-nitropentan-2-ol; (2S,3S)-3-nitropentan-2-ol; (2S,3R)-3-nitropentan-2-ol |
| Formula molecolare |
C5H11NO3 |
| Peso Molecolare |
133.1457 |
| InChI |
InChI=1/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5+/m0/s1 |
| Numero CAS |
5447-99-4 |
| EINECS |
226-669-0 |
| Struttura molecolare |
|
| Densità |
1.09g/cm3 |
| Punto di ebollizione |
215.8°C at 760 mmHg |
| Indice di rifrazione |
1.447 |
| Punto d'infiammabilità |
90.6°C |
| Pressione di vapore |
0.0314mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
