ChemNet > CAS > 57338-76-8 2,5-dimethyl-1H-pyrrole-3-carboxylic acid
57338-76-8 2,5-dimethyl-1H-pyrrole-3-carboxylic acid
| Nome del prodotto |
2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
| Nome inglese |
2,5-dimethyl-1H-pyrrole-3-carboxylic acid; 2,5-Dimethylpyrrole-3-carboxylic acid; 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Formula molecolare |
C7H8NO2 |
| Peso Molecolare |
138.1445 |
| InChI |
InChI=1/C7H9NO2/c1-4-3-6(7(9)10)5(2)8-4/h3,8H,1-2H3,(H,9,10)/p-1 |
| Numero CAS |
57338-76-8 |
| Struttura molecolare |
|
| Punto di fusione |
200℃ |
| Punto di ebollizione |
318.4°C at 760 mmHg |
| Punto d'infiammabilità |
146.4°C |
| Pressione di vapore |
0.000151mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
