ChemNet > CAS > 58081-05-3 (R)-(+)-beta-Hydroxy-gamma-butyrolactone
58081-05-3 (R)-(+)-beta-Hydroxy-gamma-butyrolactone
| Nome del prodotto |
(R)-(+)-beta-Hydroxy-gamma-butyrolactone |
| Nome inglese |
(R)-(+)-beta-Hydroxy-gamma-butyrolactone; (4R)-4-hydroxydihydrofuran-2(3H)-one; (R)-(+)-3-Hydroxybutyrolactone |
| Formula molecolare |
C4H6O3 |
| Peso Molecolare |
102.0886 |
| InChI |
InChI=1/C4H6O3/c5-3-1-4(6)7-2-3/h3,5H,1-2H2/t3-/m1/s1 |
| Numero CAS |
58081-05-3 |
| Struttura molecolare |
|
| Densità |
1.393g/cm3 |
| Punto di ebollizione |
310.3°C at 760 mmHg |
| Indice di rifrazione |
1.506 |
| Punto d'infiammabilità |
157.1°C |
| Pressione di vapore |
5.42E-05mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
