ChemNet > CAS > 59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
| Nome del prodotto |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
| Nome inglese |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride; |
| Formula molecolare |
C4H3ClN2OS |
| Peso Molecolare |
162.5974 |
| InChI |
InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
| Numero CAS |
59944-65-9 |
| Struttura molecolare |
|
| Densità |
1.504g/cm3 |
| Punto di ebollizione |
239.9°C at 760 mmHg |
| Indice di rifrazione |
1.578 |
| Punto d'infiammabilità |
98.9°C |
| Pressione di vapore |
0.0391mmHg at 25°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
