ChemNet > CAS > 608-05-9 5-methylisatin
608-05-9 5-methylisatin
| Nome del prodotto |
5-methylisatin |
| Nome inglese |
5-methylisatin; 5-methylindole-2,3(1H)-dione; 5-methyl-1H-indole-2,3-dione |
| Formula molecolare |
C9H7NO2 |
| Peso Molecolare |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| Numero CAS |
608-05-9 |
| EINECS |
210-152-1 |
| Struttura molecolare |
|
| Densità |
1.301g/cm3 |
| Punto di fusione |
180℃ (dec.) |
| Indice di rifrazione |
1.598 |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
