ChemNet > CAS > 622-46-8 Phenyl carbamate
622-46-8 Phenyl carbamate
| Nome del prodotto |
Phenyl carbamate |
| Nome inglese |
Phenyl carbamate; AI3-50866; CCRIS 5071; NSC 66509; Carbamic acid, phenyl ester |
| Formula molecolare |
C7H7NO2 |
| Peso Molecolare |
137.136 |
| InChI |
InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| Numero CAS |
622-46-8 |
| EINECS |
210-737-1 |
| Struttura molecolare |
|
| Densità |
1.2g/cm3 |
| Punto di fusione |
145-152℃ |
| Punto di ebollizione |
278.9°C at 760 mmHg |
| Indice di rifrazione |
1.551 |
| Punto d'infiammabilità |
159.3°C |
| Pressione di vapore |
0.00416mmHg at 25°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
