ChemNet > CAS > 62306-79-0 5-Methylfuran-2-boronic acid
62306-79-0 5-Methylfuran-2-boronic acid
| Nome del prodotto |
5-Methylfuran-2-boronic acid |
| Nome inglese |
5-Methylfuran-2-boronic acid; (5-Methyl-2-furanyl)-boronic acid; 5-Methylfuryl-2-boronic acid; (5-methyl-2-furyl)boronic acid |
| Formula molecolare |
C5H7BO3 |
| Peso Molecolare |
125.9183 |
| InChI |
InChI=1/C5H7BO3/c1-4-2-3-5(9-4)6(7)8/h2-3,7-8H,1H3 |
| Numero CAS |
62306-79-0 |
| Struttura molecolare |
|
| Densità |
1.197g/cm3 |
| Punto di ebollizione |
264.365°C at 760 mmHg |
| Indice di rifrazione |
1.489 |
| Punto d'infiammabilità |
113.684°C |
| Pressione di vapore |
0.005mmHg at 25°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
