ChemNet > CAS > 6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
| Nome del prodotto |
3,4-(Methylenedioxy)-6-nitrocinnamic acid |
| Nome inglese |
3,4-(Methylenedioxy)-6-nitrocinnamic acid; (2Z)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| Formula molecolare |
C10H6NO6 |
| Peso Molecolare |
236.1583 |
| InChI |
InChI=1/C10H7NO6/c12-10(13)2-1-6-3-8-9(17-5-16-8)4-7(6)11(14)15/h1-4H,5H2,(H,12,13)/p-1/b2-1+ |
| Numero CAS |
6315-90-8 |
| Struttura molecolare |
|
| Punto di ebollizione |
452.3°C at 760 mmHg |
| Punto d'infiammabilità |
227.3°C |
| Pressione di vapore |
5.73E-09mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36:Wear suitable protective clothing.;
|
|